About 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one
1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135634688) has the molecular formula C9H10N4O3S
and a molecular weight of 254.27 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 135634688 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1cnn2C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H10N4O3S/c14-9-7-3-12-13(8(7)10-5-11-9)6-1-2-17(15,16)4-6/h3,5-6H,1-2,4H2,(H,10,11,14) |
| InChIKey | CLIXWPZMUHETIQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 135634688) is 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one is O=c1[nH]cnc2c1cnn2C1CCS(=O)(=O)C1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is CLIXWPZMUHETIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O3S/c14-9-7-3-12-13(8(7)10-5-11-9)6-1-2-17(15,16)4-6/h3,5-6H,1-2,4H2,(H,10,11,14).
What are the key properties of 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 254.27 g/mol, XLogP of -0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135634688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).