C11H8ClN3O3S — CID 135634811
3-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione (PubChem CID 135634811) has the molecular formula C11H8ClN3O3S and a molecular weight of 297.72 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 135634811 |
| Molecular Formula | C11H8ClN3O3S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione |
| SMILES | O=C(CSc1n[nH]c(=O)c(=O)[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H8ClN3O3S/c12-7-3-1-6(2-4-7)8(16)5-19-11-13-9(17)10(18)14-15-11/h1-4H,5H2,(H,14,18)(H,13,15,17) |
| InChIKey | MZHZAPWZDQDAGQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|