About 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid
4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid (PubChem CID 135636204) has the molecular formula C21H14F3N3O3
and a molecular weight of 413.36 g/mol. Its IUPAC name is 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid |
| PubChem CID | 135636204 |
| Molecular Formula | C21H14F3N3O3 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid |
| SMILES | Cc1nn(-c2ccc(C(=O)O)cc2)c2nc(-c3ccc(O)cc3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C21H14F3N3O3/c1-11-18-16(21(22,23)24)10-17(12-4-8-15(28)9-5-12)25-19(18)27(26-11)14-6-2-13(3-7-14)20(29)30/h2-10,28H,1H3,(H,29,30) |
| InChIKey | IRSKAGQZHPMSOW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid?
The IUPAC name of 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid (CID 135636204) is 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid.
What is the SMILES notation for 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid?
The canonical SMILES for 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid is Cc1nn(-c2ccc(C(=O)O)cc2)c2nc(-c3ccc(O)cc3)cc(C(F)(F)F)c12.
What is the InChIKey of 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid?
The InChIKey is IRSKAGQZHPMSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F3N3O3/c1-11-18-16(21(22,23)24)10-17(12-4-8-15(28)9-5-12)25-19(18)27(26-11)14-6-2-13(3-7-14)20(29)30/h2-10,28H,1H3,(H,29,30).
What are the key properties of 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid?
4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid has a molecular weight of 413.36 g/mol, XLogP of 4.82, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(4-hydroxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-1-yl]benzoic acid is sourced from PubChem (CID 135636204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).