About 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one
2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one (PubChem CID 135636461) has the molecular formula C20H15ClN4O3
and a molecular weight of 394.82 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one.
Molecular Properties
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one |
| PubChem CID | 135636461 |
| Molecular Formula | C20H15ClN4O3 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one |
| SMILES | COc1ccc(-n2nc3ccc4c(c3n2)C(c2ccco2)CC(=O)N4)cc1Cl |
| InChI | InChI=1S/C20H15ClN4O3/c1-27-17-7-4-11(9-13(17)21)25-23-15-6-5-14-19(20(15)24-25)12(10-18(26)22-14)16-3-2-8-28-16/h2-9,12H,10H2,1H3,(H,22,26) |
| InChIKey | AMVIOEQPEUKBLR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one?
The IUPAC name of 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one (CID 135636461) is 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one.
What is the SMILES notation for 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one?
The canonical SMILES for 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one is COc1ccc(-n2nc3ccc4c(c3n2)C(c2ccco2)CC(=O)N4)cc1Cl.
What is the InChIKey of 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one?
The InChIKey is AMVIOEQPEUKBLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClN4O3/c1-27-17-7-4-11(9-13(17)21)25-23-15-6-5-14-19(20(15)24-25)12(10-18(26)22-14)16-3-2-8-28-16/h2-9,12H,10H2,1H3,(H,22,26).
What are the key properties of 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one?
2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one has a molecular weight of 394.82 g/mol, XLogP of 4.15, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4-methoxyphenyl)-9-(furan-2-yl)-8,9-dihydro-6H-triazolo[4,5-f]quinolin-7-one is sourced from PubChem (CID 135636461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).