C11H8Cl2N4S2 — CID 135638091
6-(2,5-dichlorophenyl)-3-(methylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 135638091) has the molecular formula C11H8Cl2N4S2 and a molecular weight of 331.25 g/mol. Its IUPAC name is 6-(2,5-dichlorophenyl)-3-(methylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(2,5-dichlorophenyl)-3-(methylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 135638091 |
| Molecular Formula | C11H8Cl2N4S2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 6-(2,5-dichlorophenyl)-3-(methylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CSCc1nnc2sc(-c3cc(Cl)ccc3Cl)nn12 |
| InChI | InChI=1S/C11H8Cl2N4S2/c1-18-5-9-14-15-11-17(9)16-10(19-11)7-4-6(12)2-3-8(7)13/h2-4H,5H2,1H3 |
| InChIKey | VVOUJMKSZLNEOE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |