About 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one
3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one (PubChem CID 135638382) has the molecular formula C17H18N2O5S
and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one.
Molecular Properties
| Compound Name | 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one |
| PubChem CID | 135638382 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one |
| SMILES | Cc1cc(O)c(/C=N/c2cccc(N3CCCCS3(=O)=O)c2)c(=O)o1 |
| InChI | InChI=1S/C17H18N2O5S/c1-12-9-16(20)15(17(21)24-12)11-18-13-5-4-6-14(10-13)19-7-2-3-8-25(19,22)23/h4-6,9-11,20H,2-3,7-8H2,1H3/b18-11+ |
| InChIKey | DYRQOUFFBWJUNG-WOJGMQOQSA-N |
| XLogP | 2.33 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one?
The IUPAC name of 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one (CID 135638382) is 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one.
What is the SMILES notation for 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one?
The canonical SMILES for 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one is Cc1cc(O)c(/C=N/c2cccc(N3CCCCS3(=O)=O)c2)c(=O)o1.
What is the InChIKey of 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one?
The InChIKey is DYRQOUFFBWJUNG-WOJGMQOQSA-N. The full InChI is InChI=1S/C17H18N2O5S/c1-12-9-16(20)15(17(21)24-12)11-18-13-5-4-6-14(10-13)19-7-2-3-8-25(19,22)23/h4-6,9-11,20H,2-3,7-8H2,1H3/b18-11+.
What are the key properties of 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one?
3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one has a molecular weight of 362.41 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(1,1-dioxothiazinan-2-yl)phenyl]iminomethyl]-4-hydroxy-6-methylpyran-2-one is sourced from PubChem (CID 135638382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).