C22H21NO7 — CID 135638513
8-[(2,3-dihydro-1,4-benzodioxin-6-ylazaniumyl)methyl]-3-(2-methoxy-2-oxoethyl)-4-methyl-2-oxochromen-7-olate (PubChem CID 135638513) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is 8-[(2,3-dihydro-1,4-benzodioxin-6-ylazaniumyl)methyl]-3-(2-methoxy-2-oxoethyl)-4-methyl-2-oxochromen-7-olate.
| Compound Name | 8-[(2,3-dihydro-1,4-benzodioxin-6-ylazaniumyl)methyl]-3-(2-methoxy-2-oxoethyl)-4-methyl-2-oxochromen-7-olate |
|---|---|
| PubChem CID | 135638513 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 8-[(2,3-dihydro-1,4-benzodioxin-6-ylazaniumyl)methyl]-3-(2-methoxy-2-oxoethyl)-4-methyl-2-oxochromen-7-olate |
| SMILES | COC(=O)Cc1c(C)c2ccc([O-])c(C[NH2+]c3ccc4c(c3)OCCO4)c2oc1=O |
| InChI | InChI=1S/C22H21NO7/c1-12-14-4-5-17(24)16(21(14)30-22(26)15(12)10-20(25)27-2)11-23-13-3-6-18-19(9-13)29-8-7-28-18/h3-6,9,23-24H,7-8,10-11H2,1-2H3 |
| InChIKey | TXJVRKJJOZTYRL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 114.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|