About 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid
2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid (PubChem CID 135638657) has the molecular formula C21H14O6
and a molecular weight of 362.34 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid |
| PubChem CID | 135638657 |
| Molecular Formula | C21H14O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid |
| SMILES | O=C(O)Cc1c(-c2ccc3c(c2)CCO3)oc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C21H14O6/c22-17(23)10-14-18-20(13-3-1-2-4-16(13)26-21(18)24)27-19(14)12-5-6-15-11(9-12)7-8-25-15/h1-6,9H,7-8,10H2,(H,22,23) |
| InChIKey | MRTCRACTMYSKQF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid?
The IUPAC name of 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid (CID 135638657) is 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid.
What is the SMILES notation for 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid?
The canonical SMILES for 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid is O=C(O)Cc1c(-c2ccc3c(c2)CCO3)oc2c1c(=O)oc1ccccc12.
What is the InChIKey of 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid?
The InChIKey is MRTCRACTMYSKQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14O6/c22-17(23)10-14-18-20(13-3-1-2-4-16(13)26-21(18)24)27-19(14)12-5-6-15-11(9-12)7-8-25-15/h1-6,9H,7-8,10H2,(H,22,23).
What are the key properties of 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid?
2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid has a molecular weight of 362.34 g/mol, XLogP of 3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,3-dihydro-1-benzofuran-5-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid is sourced from PubChem (CID 135638657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).