C27H31N3O2 — CID 135639348
(8R)-6-(3-methylbutyl)-2-(2-phenylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 135639348) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is (8R)-6-(3-methylbutyl)-2-(2-phenylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (8R)-6-(3-methylbutyl)-2-(2-phenylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 135639348 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (8R)-6-(3-methylbutyl)-2-(2-phenylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CC(C)CCN1CC(=O)N2C(CCc3ccccc3)c3[nH]c4ccccc4c3C[C@@H]2C1=O |
| InChI | InChI=1S/C27H31N3O2/c1-18(2)14-15-29-17-25(31)30-23(13-12-19-8-4-3-5-9-19)26-21(16-24(30)27(29)32)20-10-6-7-11-22(20)28-26/h3-11,18,23-24,28H,12-17H2,1-2H3/t23?,24-/m1/s1 |
| InChIKey | QACBVJDXXNQGGU-XMMISQBUSA-N |
| XLogP | 4.48 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|