C31H31N3O3 — CID 135639484
(8S)-6-(2-hydroxy-2-phenylethyl)-2-(4-propan-2-ylphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 135639484) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is (8S)-6-(2-hydroxy-2-phenylethyl)-2-(4-propan-2-ylphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (8S)-6-(2-hydroxy-2-phenylethyl)-2-(4-propan-2-ylphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 135639484 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | (8S)-6-(2-hydroxy-2-phenylethyl)-2-(4-propan-2-ylphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CC(C)c1ccc(C2c3[nH]c4ccccc4c3C[C@H]3C(=O)N(CC(O)c4ccccc4)CC(=O)N23)cc1 |
| InChI | InChI=1S/C31H31N3O3/c1-19(2)20-12-14-22(15-13-20)30-29-24(23-10-6-7-11-25(23)32-29)16-26-31(37)33(18-28(36)34(26)30)17-27(35)21-8-4-3-5-9-21/h3-15,19,26-27,30,32,35H,16-18H2,1-2H3/t26-,27?,30?/m0/s1 |
| InChIKey | MHWKAOVULITPHV-WSEDSVFCSA-N |
| XLogP | 4.71 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|