C35H45N3O5 — CID 135640680
(1S,14S,18S,19S)-6-[2-(3,4-dimethoxyphenyl)ethyl]-19-hydroxy-14,18,19-trimethyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5(10),11-triene-7,9-dione (PubChem CID 135640680) has the molecular formula C35H45N3O5 and a molecular weight of 587.76 g/mol. Its IUPAC name is (1S,14S,18S,19S)-6-[2-(3,4-dimethoxyphenyl)ethyl]-19-hydroxy-14,18,19-trimethyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5(10),11-triene-7,9-dione.
| Compound Name | (1S,14S,18S,19S)-6-[2-(3,4-dimethoxyphenyl)ethyl]-19-hydroxy-14,18,19-trimethyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5(10),11-triene-7,9-dione |
|---|---|
| PubChem CID | 135640680 |
| Molecular Formula | C35H45N3O5 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.34 |
| IUPAC Name | (1S,14S,18S,19S)-6-[2-(3,4-dimethoxyphenyl)ethyl]-19-hydroxy-14,18,19-trimethyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5(10),11-triene-7,9-dione |
| SMILES | COc1ccc(CCn2c(=O)[nH]c(=O)c3cc4c(nc32)C[C@@H]2CCC3C5CC[C@](C)(O)[C@@]5(C)CCC3[C@@]2(C)C4)cc1OC |
| InChI | InChI=1S/C35H45N3O5/c1-33-19-21-17-24-30(38(32(40)37-31(24)39)15-12-20-6-9-28(42-4)29(16-20)43-5)36-27(21)18-22(33)7-8-23-25(33)10-13-34(2)26(23)11-14-35(34,3)41/h6,9,16-17,22-23,25-26,41H,7-8,10-15,18-19H2,1-5H3,(H,37,39,40)/t22-,23?,25?,26?,33-,34-,35-/m0/s1 |
| InChIKey | NBBRSXDYLFNZNT-AILZQMLCSA-N |
| XLogP | 5.05 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |