About 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol
2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol (PubChem CID 135641165) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol.
Molecular Properties
| Compound Name | 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol |
| PubChem CID | 135641165 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol |
| SMILES | C/C(=N\n1cnnc1)c1ccccc1O |
| InChI | InChI=1S/C10H10N4O/c1-8(13-14-6-11-12-7-14)9-4-2-3-5-10(9)15/h2-7,15H,1H3/b13-8+ |
| InChIKey | JDFACINZBUFURC-MDWZMJQESA-N |
| XLogP | 1.26 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol?
The IUPAC name of 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol (CID 135641165) is 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol.
What is the SMILES notation for 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol?
The canonical SMILES for 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol is C/C(=N\n1cnnc1)c1ccccc1O.
What is the InChIKey of 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol?
The InChIKey is JDFACINZBUFURC-MDWZMJQESA-N. The full InChI is InChI=1S/C10H10N4O/c1-8(13-14-6-11-12-7-14)9-4-2-3-5-10(9)15/h2-7,15H,1H3/b13-8+.
What are the key properties of 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol?
2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol has a molecular weight of 202.22 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-C-methyl-N-(1,2,4-triazol-4-yl)carbonimidoyl]phenol is sourced from PubChem (CID 135641165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).