About 4-methanimidoylbenzene-1,3-diol;N-methylaniline
4-methanimidoylbenzene-1,3-diol;N-methylaniline (PubChem CID 135641187) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-methanimidoylbenzene-1,3-diol;N-methylaniline.
Molecular Properties
| Compound Name | 4-methanimidoylbenzene-1,3-diol;N-methylaniline |
| PubChem CID | 135641187 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-methanimidoylbenzene-1,3-diol;N-methylaniline |
| SMILES | CNc1ccccc1.[H]/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C7H7NO2.C7H9N/c8-4-5-1-2-6(9)3-7(5)10;1-8-7-5-3-2-4-6-7/h1-4,8-10H;2-6,8H,1H3/b8-4+; |
| InChIKey | HRXVCDXCABTWPD-ZFXMFRGYSA-N |
| XLogP | 2.82 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methanimidoylbenzene-1,3-diol;N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methanimidoylbenzene-1,3-diol;N-methylaniline?
The IUPAC name of 4-methanimidoylbenzene-1,3-diol;N-methylaniline (CID 135641187) is 4-methanimidoylbenzene-1,3-diol;N-methylaniline.
What is the SMILES notation for 4-methanimidoylbenzene-1,3-diol;N-methylaniline?
The canonical SMILES for 4-methanimidoylbenzene-1,3-diol;N-methylaniline is CNc1ccccc1.[H]/N=C/c1ccc(O)cc1O.
What is the InChIKey of 4-methanimidoylbenzene-1,3-diol;N-methylaniline?
The InChIKey is HRXVCDXCABTWPD-ZFXMFRGYSA-N. The full InChI is InChI=1S/C7H7NO2.C7H9N/c8-4-5-1-2-6(9)3-7(5)10;1-8-7-5-3-2-4-6-7/h1-4,8-10H;2-6,8H,1H3/b8-4+;.
What are the key properties of 4-methanimidoylbenzene-1,3-diol;N-methylaniline?
4-methanimidoylbenzene-1,3-diol;N-methylaniline has a molecular weight of 244.29 g/mol, XLogP of 2.82, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methanimidoylbenzene-1,3-diol;N-methylaniline is sourced from PubChem (CID 135641187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).