C18H12Br2N2O4 — CID 135641258
N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 135641258) has the molecular formula C18H12Br2N2O4 and a molecular weight of 480.11 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 135641258 |
| Molecular Formula | C18H12Br2N2O4 |
| Molecular Weight | 480.11 g/mol |
| Exact Mass | 477.92 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(O)c(Br)c1O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C18H12Br2N2O4/c19-13-6-11(16(24)15(20)17(13)25)8-21-22-18(26)12-5-9-3-1-2-4-10(9)7-14(12)23/h1-8,23-25H,(H,22,26)/b21-8+ |
| InChIKey | QITNYKPAIYQWMI-ODCIPOBUSA-N |
| XLogP | 4.25 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.11 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|