C10H8BrN3OS — CID 135641774
(2E)-2-[(E)-(3-bromophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135641774) has the molecular formula C10H8BrN3OS and a molecular weight of 298.17 g/mol. Its IUPAC name is (2E)-2-[(E)-(3-bromophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-(3-bromophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135641774 |
| Molecular Formula | C10H8BrN3OS |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | (2E)-2-[(E)-(3-bromophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N/N=C/c2cccc(Br)c2)N1 |
| InChI | InChI=1S/C10H8BrN3OS/c11-8-3-1-2-7(4-8)5-12-14-10-13-9(15)6-16-10/h1-5H,6H2,(H,13,14,15)/b12-5+ |
| InChIKey | BIMWWQTZLQPHIF-LFYBBSHMSA-N |
| XLogP | 2.00 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|