About (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one
(2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135641784) has the molecular formula C12H13N3O3S
and a molecular weight of 279.32 g/mol. Its IUPAC name is (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| PubChem CID | 135641784 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(/C=N/N=C2\NC(=O)CS2)c1OC |
| InChI | InChI=1S/C12H13N3O3S/c1-17-9-5-3-4-8(11(9)18-2)6-13-15-12-14-10(16)7-19-12/h3-6H,7H2,1-2H3,(H,14,15,16)/b13-6+ |
| InChIKey | VUQFLUMMOWOYDE-AWNIVKPZSA-N |
| XLogP | 1.26 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
The IUPAC name of (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (CID 135641784) is (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
What is the SMILES notation for (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
The canonical SMILES for (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one is COc1cccc(/C=N/N=C2\NC(=O)CS2)c1OC.
What is the InChIKey of (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
The InChIKey is VUQFLUMMOWOYDE-AWNIVKPZSA-N. The full InChI is InChI=1S/C12H13N3O3S/c1-17-9-5-3-4-8(11(9)18-2)6-13-15-12-14-10(16)7-19-12/h3-6H,7H2,1-2H3,(H,14,15,16)/b13-6+.
What are the key properties of (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
(2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one has a molecular weight of 279.32 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(E)-(2,3-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one is sourced from PubChem (CID 135641784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).