C17H19N7O2S2 — CID 135643199
1-(4-ethoxyphenyl)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]guanidine (PubChem CID 135643199) has the molecular formula C17H19N7O2S2 and a molecular weight of 417.52 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]guanidine.
| Compound Name | 1-(4-ethoxyphenyl)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]guanidine |
|---|---|
| PubChem CID | 135643199 |
| Molecular Formula | C17H19N7O2S2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]guanidine |
| SMILES | CCOc1ccc(N/C(N)=N/c2nc(CSc3nnc(C)s3)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H19N7O2S2/c1-3-26-13-6-4-11(5-7-13)19-15(18)22-16-20-12(8-14(25)21-16)9-27-17-24-23-10(2)28-17/h4-8H,3,9H2,1-2H3,(H4,18,19,20,21,22,25) |
| InChIKey | UAXHXLMDNJWYMK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|