C16H12Cl2N4O3S — CID 135643480
(2Z)-N-(3,4-dichlorophenyl)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 135643480) has the molecular formula C16H12Cl2N4O3S and a molecular weight of 411.27 g/mol. Its IUPAC name is (2Z)-N-(3,4-dichlorophenyl)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (2Z)-N-(3,4-dichlorophenyl)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135643480 |
| Molecular Formula | C16H12Cl2N4O3S |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | (2Z)-N-(3,4-dichlorophenyl)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccc(Cl)c(Cl)c2)S/C(=N\N=C\c2ccco2)N1 |
| InChI | InChI=1S/C16H12Cl2N4O3S/c17-11-4-3-9(6-12(11)18)20-15(24)13-7-14(23)21-16(26-13)22-19-8-10-2-1-5-25-10/h1-6,8,13H,7H2,(H,20,24)(H,21,22,23)/b19-8+ |
| InChIKey | WZYNWVLMUUPGDS-UFWORHAWSA-N |
| XLogP | 3.54 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|