C20H20N4O5S2 — CID 135643574
2-[(2Z)-2-[(Z)-1-[4-[(4-methylphenyl)sulfonylamino]phenyl]ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135643574) has the molecular formula C20H20N4O5S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 2-[(2Z)-2-[(Z)-1-[4-[(4-methylphenyl)sulfonylamino]phenyl]ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z)-2-[(Z)-1-[4-[(4-methylphenyl)sulfonylamino]phenyl]ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135643574 |
| Molecular Formula | C20H20N4O5S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-[(2Z)-2-[(Z)-1-[4-[(4-methylphenyl)sulfonylamino]phenyl]ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | C/C(=N/N=C1/NC(=O)C(CC(=O)O)S1)c1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H20N4O5S2/c1-12-3-9-16(10-4-12)31(28,29)24-15-7-5-14(6-8-15)13(2)22-23-20-21-19(27)17(30-20)11-18(25)26/h3-10,17,24H,11H2,1-2H3,(H,25,26)(H,21,23,27)/b22-13- |
| InChIKey | SWQOMGDFPOHHTE-XKZIYDEJSA-N |
| XLogP | 2.58 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|