About 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one
4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 135645110) has the molecular formula C20H16ClN5O
and a molecular weight of 377.84 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 135645110 |
| Molecular Formula | C20H16ClN5O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(Nc2nc(-c3ccccc3Cl)cc(=O)[nH]2)nc2c(C)cccc12 |
| InChI | InChI=1S/C20H16ClN5O/c1-11-6-5-8-13-12(2)22-19(25-18(11)13)26-20-23-16(10-17(27)24-20)14-7-3-4-9-15(14)21/h3-10H,1-2H3,(H2,22,23,24,25,26,27) |
| InChIKey | PMTYLPUFWRXYAS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one (CID 135645110) is 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one is Cc1nc(Nc2nc(-c3ccccc3Cl)cc(=O)[nH]2)nc2c(C)cccc12.
What is the InChIKey of 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one?
The InChIKey is PMTYLPUFWRXYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN5O/c1-11-6-5-8-13-12(2)22-19(25-18(11)13)26-20-23-16(10-17(27)24-20)14-7-3-4-9-15(14)21/h3-10H,1-2H3,(H2,22,23,24,25,26,27).
What are the key properties of 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one?
4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one has a molecular weight of 377.84 g/mol, XLogP of 4.39, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorophenyl)-2-[(4,8-dimethylquinazolin-2-yl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 135645110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).