C22H23N3O6 — CID 135645281
ethyl 2-oxo-4-(2,3,4-trimethoxyphenyl)-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 135645281) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is ethyl 2-oxo-4-(2,3,4-trimethoxyphenyl)-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl 2-oxo-4-(2,3,4-trimethoxyphenyl)-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 135645281 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl 2-oxo-4-(2,3,4-trimethoxyphenyl)-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)Nc2nc3ccccc3n2C1c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C22H23N3O6/c1-5-31-21(27)16-17(12-10-11-15(28-2)19(30-4)18(12)29-3)25-14-9-7-6-8-13(14)23-22(25)24-20(16)26/h6-11,16-17H,5H2,1-4H3,(H,23,24,26) |
| InChIKey | QXOONSPHDAWTHI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|