C18H17N3O3 — CID 135645511
2-anilino-4-(3,4-dimethoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 135645511) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-anilino-4-(3,4-dimethoxyphenyl)-1H-pyrimidin-6-one.
| Compound Name | 2-anilino-4-(3,4-dimethoxyphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135645511 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-anilino-4-(3,4-dimethoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | COc1ccc(-c2cc(=O)[nH]c(Nc3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C18H17N3O3/c1-23-15-9-8-12(10-16(15)24-2)14-11-17(22)21-18(20-14)19-13-6-4-3-5-7-13/h3-11H,1-2H3,(H2,19,20,21,22) |
| InChIKey | QGDVJEIIAUKMBX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |