C10H8F5N3O — CID 135645637
1,3-dimethyl-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135645637) has the molecular formula C10H8F5N3O and a molecular weight of 281.18 g/mol. Its IUPAC name is 1,3-dimethyl-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 1,3-dimethyl-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135645637 |
| Molecular Formula | C10H8F5N3O |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 1,3-dimethyl-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1nn(C)c2[nH]c(=O)cc(C(F)(F)C(F)(F)F)c12 |
| InChI | InChI=1S/C10H8F5N3O/c1-4-7-5(9(11,12)10(13,14)15)3-6(19)16-8(7)18(2)17-4/h3H,1-2H3,(H,16,19) |
| InChIKey | OVZSYRZJPBKQJO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|