C13H14F5N3O — CID 135645642
1-butyl-3-methyl-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135645642) has the molecular formula C13H14F5N3O and a molecular weight of 323.27 g/mol. Its IUPAC name is 1-butyl-3-methyl-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 1-butyl-3-methyl-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135645642 |
| Molecular Formula | C13H14F5N3O |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-butyl-3-methyl-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CCCCn1nc(C)c2c(C(F)(F)C(F)(F)F)cc(=O)[nH]c21 |
| InChI | InChI=1S/C13H14F5N3O/c1-3-4-5-21-11-10(7(2)20-21)8(6-9(22)19-11)12(14,15)13(16,17)18/h6H,3-5H2,1-2H3,(H,19,22) |
| InChIKey | IAENOLWDUSOWMV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|