C28H24N2O8 — CID 1356468
2,6-bis[2-(4-methoxyphenoxy)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 1356468) has the molecular formula C28H24N2O8 and a molecular weight of 516.51 g/mol. Its IUPAC name is 2,6-bis[2-(4-methoxyphenoxy)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[2-(4-methoxyphenoxy)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 1356468 |
| Molecular Formula | C28H24N2O8 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2,6-bis[2-(4-methoxyphenoxy)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | COc1ccc(OCCn2c(=O)c3cc4c(=O)n(CCOc5ccc(OC)cc5)c(=O)c4cc3c2=O)cc1 |
| InChI | InChI=1S/C28H24N2O8/c1-35-17-3-7-19(8-4-17)37-13-11-29-25(31)21-15-23-24(16-22(21)26(29)32)28(34)30(27(23)33)12-14-38-20-9-5-18(36-2)6-10-20/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | LOPZAYRFCAJQDW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 115.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |