C18H17F3N4O2 — CID 135647261
9-(3-methoxyphenyl)-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135647261) has the molecular formula C18H17F3N4O2 and a molecular weight of 378.35 g/mol. Its IUPAC name is 9-(3-methoxyphenyl)-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(3-methoxyphenyl)-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135647261 |
| Molecular Formula | C18H17F3N4O2 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 9-(3-methoxyphenyl)-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cccc(C2C3=C(CC(C)CC3=O)Nc3nc(C(F)(F)F)nn32)c1 |
| InChI | InChI=1S/C18H17F3N4O2/c1-9-6-12-14(13(26)7-9)15(10-4-3-5-11(8-10)27-2)25-17(22-12)23-16(24-25)18(19,20)21/h3-5,8-9,15H,6-7H2,1-2H3,(H,22,23,24) |
| InChIKey | PLZIEWGKTRXULA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |