C17H16N4O4 — CID 135648265
N,N'-bis[(E)-(4-hydroxyphenyl)methylideneamino]propanediamide (PubChem CID 135648265) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is N,N'-bis[(E)-(4-hydroxyphenyl)methylideneamino]propanediamide.
| Compound Name | N,N'-bis[(E)-(4-hydroxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 135648265 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N,N'-bis[(E)-(4-hydroxyphenyl)methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)N/N=C/c1ccc(O)cc1)N/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C17H16N4O4/c22-14-5-1-12(2-6-14)10-18-20-16(24)9-17(25)21-19-11-13-3-7-15(23)8-4-13/h1-8,10-11,22-23H,9H2,(H,20,24)(H,21,25)/b18-10+,19-11+ |
| InChIKey | QJTBIGLYHXSOOR-XOBNHNQQSA-N |
| XLogP | 1.09 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|