C24H19ClN4O3 — CID 135648416
3-[2-[(4-chlorophenyl)methoxy]phenyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 135648416) has the molecular formula C24H19ClN4O3 and a molecular weight of 446.89 g/mol. Its IUPAC name is 3-[2-[(4-chlorophenyl)methoxy]phenyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[2-[(4-chlorophenyl)methoxy]phenyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135648416 |
| Molecular Formula | C24H19ClN4O3 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 3-[2-[(4-chlorophenyl)methoxy]phenyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)c1cc(-c2ccccc2OCc2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C24H19ClN4O3/c25-18-11-9-16(10-12-18)15-32-23-8-4-2-6-19(23)20-13-21(28-27-20)24(31)29-26-14-17-5-1-3-7-22(17)30/h1-14,30H,15H2,(H,27,28)(H,29,31)/b26-14+ |
| InChIKey | DEPUNQZGSCQPIO-VULFUBBASA-N |
| XLogP | 4.78 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|