About (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one
(2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135648558) has the molecular formula C10H7Br2N3O2S
and a molecular weight of 393.06 g/mol. Its IUPAC name is (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| PubChem CID | 135648558 |
| Molecular Formula | C10H7Br2N3O2S |
| Molecular Weight | 393.06 g/mol |
| Exact Mass | 390.86 |
| IUPAC Name | (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N/N=C/c2cc(Br)cc(Br)c2O)N1 |
| InChI | InChI=1S/C10H7Br2N3O2S/c11-6-1-5(9(17)7(12)2-6)3-13-15-10-14-8(16)4-18-10/h1-3,17H,4H2,(H,14,15,16)/b13-3+ |
| InChIKey | XNOWWTBMMKXRCZ-QLKAYGNNSA-N |
| XLogP | 2.47 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.06 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
The IUPAC name of (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (CID 135648558) is (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
What is the SMILES notation for (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
The canonical SMILES for (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one is O=C1CS/C(=N/N=C/c2cc(Br)cc(Br)c2O)N1.
What is the InChIKey of (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
The InChIKey is XNOWWTBMMKXRCZ-QLKAYGNNSA-N. The full InChI is InChI=1S/C10H7Br2N3O2S/c11-6-1-5(9(17)7(12)2-6)3-13-15-10-14-8(16)4-18-10/h1-3,17H,4H2,(H,14,15,16)/b13-3+.
What are the key properties of (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
(2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one has a molecular weight of 393.06 g/mol, XLogP of 2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one is sourced from PubChem (CID 135648558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).