C20H15N3O3S — CID 135648933
N-[4-hydroxy-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-2-phenylsulfanylacetamide (PubChem CID 135648933) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is N-[4-hydroxy-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[4-hydroxy-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 135648933 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[4-hydroxy-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)Nc1ccc(O)c(-c2nc3ncccc3o2)c1 |
| InChI | InChI=1S/C20H15N3O3S/c24-16-9-8-13(22-18(25)12-27-14-5-2-1-3-6-14)11-15(16)20-23-19-17(26-20)7-4-10-21-19/h1-11,24H,12H2,(H,22,25) |
| InChIKey | DUYIWIHKAHZUAH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|