C9H6Cl2N4O — CID 135650425
2,4-dichloro-6-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol (PubChem CID 135650425) has the molecular formula C9H6Cl2N4O and a molecular weight of 257.08 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol |
|---|---|
| PubChem CID | 135650425 |
| Molecular Formula | C9H6Cl2N4O |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 2,4-dichloro-6-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/c1ncn[nH]1 |
| InChI | InChI=1S/C9H6Cl2N4O/c10-6-1-5(8(16)7(11)2-6)3-12-9-13-4-14-15-9/h1-4,16H,(H,13,14,15)/b12-3+ |
| InChIKey | TYOUAJGUAOUJES-KGVSQERTSA-N |
| XLogP | 2.57 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|