C17H22N4O3 — CID 135650461
3-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 135650461) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135650461 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CCn2nc(C)cc2C)ccc1O |
| InChI | InChI=1S/C17H22N4O3/c1-4-24-16-10-14(5-6-15(16)22)11-18-19-17(23)7-8-21-13(3)9-12(2)20-21/h5-6,9-11,22H,4,7-8H2,1-3H3,(H,19,23)/b18-11+ |
| InChIKey | YJCDWOHYNJBXOD-WOJGMQOQSA-N |
| XLogP | 2.14 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|