C28H27N7O6 — CID 135651312
8'-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]-3'-phenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 135651312) has the molecular formula C28H27N7O6 and a molecular weight of 557.57 g/mol. Its IUPAC name is 8'-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]-3'-phenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 8'-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]-3'-phenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 135651312 |
| Molecular Formula | C28H27N7O6 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 8'-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]-3'-phenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | Cn1c(O)c(/C=N/c2ccc3c(c2)CC2(C(=O)NC(=O)NC2=O)C2CN(c4ccccc4)CCN32)c(=O)n(C)c1=O |
| InChI | InChI=1S/C28H27N7O6/c1-32-22(36)19(23(37)33(2)27(32)41)14-29-17-8-9-20-16(12-17)13-28(24(38)30-26(40)31-25(28)39)21-15-34(10-11-35(20)21)18-6-4-3-5-7-18/h3-9,12,14,21,36H,10-11,13,15H2,1-2H3,(H2,30,31,38,39,40)/b29-14+ |
| InChIKey | JLMBJNTVEPGZRK-IPPBACCNSA-N |
| XLogP | 0.14 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|