C14H11F2N3O2 — CID 135651886
5-(2,5-difluorophenyl)-2-methyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135651886) has the molecular formula C14H11F2N3O2 and a molecular weight of 291.26 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-2-methyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2,5-difluorophenyl)-2-methyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135651886 |
| Molecular Formula | C14H11F2N3O2 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-(2,5-difluorophenyl)-2-methyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cc1nc2c(c(=O)[nH]1)C(c1cc(F)ccc1F)CC(=O)N2 |
| InChI | InChI=1S/C14H11F2N3O2/c1-6-17-13-12(14(21)18-6)9(5-11(20)19-13)8-4-7(15)2-3-10(8)16/h2-4,9H,5H2,1H3,(H2,17,18,19,20,21) |
| InChIKey | QSFRDSFWMRVZBQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |