About 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid
2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid (PubChem CID 135652094) has the molecular formula C9H9N3O7
and a molecular weight of 271.19 g/mol. Its IUPAC name is 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid.
Molecular Properties
| Compound Name | 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid |
| PubChem CID | 135652094 |
| Molecular Formula | C9H9N3O7 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid |
| SMILES | O=C(O)CC(/N=C/c1c(O)[nH]c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C9H9N3O7/c13-5(14)1-4(8(17)18)10-2-3-6(15)11-9(19)12-7(3)16/h2,4H,1H2,(H,13,14)(H,17,18)(H3,11,12,15,16,19)/b10-2+ |
| InChIKey | SDSTUWUKOUYHFU-WTDSWWLTSA-N |
| XLogP | -1.88 |
| TPSA | 172.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid?
The IUPAC name of 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid (CID 135652094) is 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid.
What is the SMILES notation for 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid?
The canonical SMILES for 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid is O=C(O)CC(/N=C/c1c(O)[nH]c(=O)[nH]c1=O)C(=O)O.
What is the InChIKey of 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid?
The InChIKey is SDSTUWUKOUYHFU-WTDSWWLTSA-N. The full InChI is InChI=1S/C9H9N3O7/c13-5(14)1-4(8(17)18)10-2-3-6(15)11-9(19)12-7(3)16/h2,4H,1H2,(H,13,14)(H,17,18)(H3,11,12,15,16,19)/b10-2+.
What are the key properties of 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid?
2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid has a molecular weight of 271.19 g/mol, XLogP of -1.88, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]butanedioic acid is sourced from PubChem (CID 135652094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).