C18H28N4OS — CID 135652713
4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-(2,2,6,6-tetramethylpiperidin-4-yl)-2H-pyrrol-3-ol (PubChem CID 135652713) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-(2,2,6,6-tetramethylpiperidin-4-yl)-2H-pyrrol-3-ol.
| Compound Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-(2,2,6,6-tetramethylpiperidin-4-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135652713 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-(2,2,6,6-tetramethylpiperidin-4-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1\C(c2nc(C)c(C)s2)=C(O)CN1C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C18H28N4OS/c1-10-11(2)24-16(20-10)14-13(23)9-22(15(14)19)12-7-17(3,4)21-18(5,6)8-12/h12,19,21,23H,7-9H2,1-6H3/b19-15+ |
| InChIKey | DUIXJNPAWMBOPI-XDJHFCHBSA-N |
| XLogP | 3.63 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|