C15H16N4O3S2 — CID 135652812
4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzenesulfonamide (PubChem CID 135652812) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 135652812 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzenesulfonamide |
| SMILES | [H]/N=C1\C(c2nc(C)c(C)s2)=C(O)CN1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H16N4O3S2/c1-8-9(2)23-15(18-8)13-12(20)7-19(14(13)16)10-3-5-11(6-4-10)24(17,21)22/h3-6,16,20H,7H2,1-2H3,(H2,17,21,22)/b16-14+ |
| InChIKey | LAHOKHAAUVKPPO-JQIJEIRASA-N |
| XLogP | 2.17 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|