C13H17N3O4S2 — CID 135652988
4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(4-hydroxy-1,1-dioxothiolan-3-yl)-5-imino-2H-pyrrol-3-ol (PubChem CID 135652988) has the molecular formula C13H17N3O4S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(4-hydroxy-1,1-dioxothiolan-3-yl)-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(4-hydroxy-1,1-dioxothiolan-3-yl)-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135652988 |
| Molecular Formula | C13H17N3O4S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(4-hydroxy-1,1-dioxothiolan-3-yl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1\C(c2nc(C)c(C)s2)=C(O)CN1C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C13H17N3O4S2/c1-6-7(2)21-13(15-6)11-9(17)3-16(12(11)14)8-4-22(19,20)5-10(8)18/h8,10,14,17-18H,3-5H2,1-2H3/b14-12+ |
| InChIKey | MAAWBSOQASGQEL-WYMLVPIESA-N |
| XLogP | 0.48 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|