About 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol
1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol (PubChem CID 135653035) has the molecular formula C17H25N3OS
and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol.
Molecular Properties
| Compound Name | 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol |
| PubChem CID | 135653035 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1\C(c2nc(C)c(C)s2)=C(O)CN1C1CCCCCCC1 |
| InChI | InChI=1S/C17H25N3OS/c1-11-12(2)22-17(19-11)15-14(21)10-20(16(15)18)13-8-6-4-3-5-7-9-13/h13,18,21H,3-10H2,1-2H3/b18-16+ |
| InChIKey | UOWQPQDCPRJPGR-FBMGVBCBSA-N |
| XLogP | 4.43 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol?
The IUPAC name of 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol (CID 135653035) is 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol.
What is the SMILES notation for 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol?
The canonical SMILES for 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol is [H]/N=C1\C(c2nc(C)c(C)s2)=C(O)CN1C1CCCCCCC1.
What is the InChIKey of 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol?
The InChIKey is UOWQPQDCPRJPGR-FBMGVBCBSA-N. The full InChI is InChI=1S/C17H25N3OS/c1-11-12(2)22-17(19-11)15-14(21)10-20(16(15)18)13-8-6-4-3-5-7-9-13/h13,18,21H,3-10H2,1-2H3/b18-16+.
What are the key properties of 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol?
1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol has a molecular weight of 319.47 g/mol, XLogP of 4.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclooctyl-4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-2H-pyrrol-3-ol is sourced from PubChem (CID 135653035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).