C19H17ClN4O3S — CID 135653069
4-[(4-chlorophenoxy)methyl]-14,14-dimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one (PubChem CID 135653069) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-14,14-dimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-14,14-dimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one |
|---|---|
| PubChem CID | 135653069 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-14,14-dimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one |
| SMILES | CC1(C)Cc2c(sc3[nH]c(=O)n4nc(COc5ccc(Cl)cc5)nc4c23)CO1 |
| InChI | InChI=1S/C19H17ClN4O3S/c1-19(2)7-12-13(8-27-19)28-17-15(12)16-21-14(23-24(16)18(25)22-17)9-26-11-5-3-10(20)4-6-11/h3-6H,7-9H2,1-2H3,(H,22,25) |
| InChIKey | SIHAQNDAKFGPRJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |