C21H14N2O5S2 — CID 135653088
(7E)-7-[[4-hydroxy-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 135653088) has the molecular formula C21H14N2O5S2 and a molecular weight of 438.49 g/mol. Its IUPAC name is (7E)-7-[[4-hydroxy-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | (7E)-7-[[4-hydroxy-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 135653088 |
| Molecular Formula | C21H14N2O5S2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | (7E)-7-[[4-hydroxy-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | COc1ccc(-n2c(O)c(/C=C3\C=c4cc5c(cc4=NC3=O)OCO5)sc2=S)cc1 |
| InChI | InChI=1S/C21H14N2O5S2/c1-26-14-4-2-13(3-5-14)23-20(25)18(30-21(23)29)8-12-6-11-7-16-17(28-10-27-16)9-15(11)22-19(12)24/h2-9,25H,10H2,1H3/b12-8+ |
| InChIKey | ZYSJVZSCWQJZOK-XYOKQWHBSA-N |
| XLogP | 2.74 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|