C22H17N5O2S — CID 135653384
6-methyl-8-(4-methylsulfanylphenyl)-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 135653384) has the molecular formula C22H17N5O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is 6-methyl-8-(4-methylsulfanylphenyl)-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 6-methyl-8-(4-methylsulfanylphenyl)-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 135653384 |
| Molecular Formula | C22H17N5O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 6-methyl-8-(4-methylsulfanylphenyl)-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | CSc1ccc(-c2c3c(C)nn(-c4ccccc4)c3nc3[nH]c(=O)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C22H17N5O2S/c1-12-16-17(13-8-10-15(30-2)11-9-13)18-19(24-22(29)25-21(18)28)23-20(16)27(26-12)14-6-4-3-5-7-14/h3-11H,1-2H3,(H2,23,24,25,28,29) |
| InChIKey | DFANCYQUTNXHCG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |