C15H12ClFN4O2 — CID 135654162
5-(5-chloro-2-fluorophenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one (PubChem CID 135654162) has the molecular formula C15H12ClFN4O2 and a molecular weight of 334.74 g/mol. Its IUPAC name is 5-(5-chloro-2-fluorophenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one.
| Compound Name | 5-(5-chloro-2-fluorophenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 135654162 |
| Molecular Formula | C15H12ClFN4O2 |
| Molecular Weight | 334.74 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 5-(5-chloro-2-fluorophenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
| SMILES | O=C1CCCC2=C1C(c1cc(Cl)ccc1F)Nc1nonc1N2 |
| InChI | InChI=1S/C15H12ClFN4O2/c16-7-4-5-9(17)8(6-7)13-12-10(2-1-3-11(12)22)18-14-15(19-13)21-23-20-14/h4-6,13H,1-3H2,(H,18,20)(H,19,21) |
| InChIKey | KQWOCDRMDSBBDH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |