C22H15ClN4O2 — CID 135655777
1-(4-chlorophenyl)-1'-prop-2-ynylspiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione (PubChem CID 135655777) has the molecular formula C22H15ClN4O2 and a molecular weight of 402.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1'-prop-2-ynylspiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione.
| Compound Name | 1-(4-chlorophenyl)-1'-prop-2-ynylspiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione |
|---|---|
| PubChem CID | 135655777 |
| Molecular Formula | C22H15ClN4O2 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 1-(4-chlorophenyl)-1'-prop-2-ynylspiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione |
| SMILES | C#CCN1C(=O)C2(CC(=O)Nc3c2cnn3-c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H15ClN4O2/c1-2-11-26-18-6-4-3-5-16(18)22(21(26)29)12-19(28)25-20-17(22)13-24-27(20)15-9-7-14(23)8-10-15/h1,3-10,13H,11-12H2,(H,25,28) |
| InChIKey | BMRWODDENSQJRC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|