C19H25BrN4O3S2 — CID 135656185
1-[3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-3-cyclohexyl-1-hydroxyurea (PubChem CID 135656185) has the molecular formula C19H25BrN4O3S2 and a molecular weight of 501.47 g/mol. Its IUPAC name is 1-[3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-3-cyclohexyl-1-hydroxyurea.
| Compound Name | 1-[3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-3-cyclohexyl-1-hydroxyurea |
|---|---|
| PubChem CID | 135656185 |
| Molecular Formula | C19H25BrN4O3S2 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 1-[3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-3-cyclohexyl-1-hydroxyurea |
| SMILES | CC1(C)SC(=S)N(/N=C/c2cc(Br)ccc2O)C1N(O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H25BrN4O3S2/c1-19(2)16(24(27)17(26)22-14-6-4-3-5-7-14)23(18(28)29-19)21-11-12-10-13(20)8-9-15(12)25/h8-11,14,16,25,27H,3-7H2,1-2H3,(H,22,26)/b21-11+ |
| InChIKey | HHXFEMQMZNHNNK-SRZZPIQSSA-N |
| XLogP | 4.66 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|