C18H16N2O4S — CID 135657522
6-(2-hydroxy-4-methoxyphenyl)-5-(2-methoxyphenoxy)-1H-pyrimidine-2-thione (PubChem CID 135657522) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 6-(2-hydroxy-4-methoxyphenyl)-5-(2-methoxyphenoxy)-1H-pyrimidine-2-thione.
| Compound Name | 6-(2-hydroxy-4-methoxyphenyl)-5-(2-methoxyphenoxy)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 135657522 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 6-(2-hydroxy-4-methoxyphenyl)-5-(2-methoxyphenoxy)-1H-pyrimidine-2-thione |
| SMILES | COc1ccc(-c2[nH]c(=S)ncc2Oc2ccccc2OC)c(O)c1 |
| InChI | InChI=1S/C18H16N2O4S/c1-22-11-7-8-12(13(21)9-11)17-16(10-19-18(25)20-17)24-15-6-4-3-5-14(15)23-2/h3-10,21H,1-2H3,(H,19,20,25) |
| InChIKey | VAEWEHUXYMQDEB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|