About 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol
5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol (PubChem CID 135657525) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol.
Molecular Properties
| Compound Name | 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol |
| PubChem CID | 135657525 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol |
| SMILES | COc1ccc(-c2oncc2-c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C16H13NO3/c1-19-12-7-8-13(15(18)9-12)16-14(10-17-20-16)11-5-3-2-4-6-11/h2-10,18H,1H3 |
| InChIKey | SCTPSQZXBZIJKV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol?
The IUPAC name of 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol (CID 135657525) is 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol.
What is the SMILES notation for 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol?
The canonical SMILES for 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol is COc1ccc(-c2oncc2-c2ccccc2)c(O)c1.
What is the InChIKey of 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol?
The InChIKey is SCTPSQZXBZIJKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3/c1-19-12-7-8-13(15(18)9-12)16-14(10-17-20-16)11-5-3-2-4-6-11/h2-10,18H,1H3.
What are the key properties of 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol?
5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol has a molecular weight of 267.28 g/mol, XLogP of 3.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-(4-phenyl-1,2-oxazol-5-yl)phenol is sourced from PubChem (CID 135657525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).