C14H12N4O5S — CID 135658903
3-methyl-4-(6-nitro-1,3-benzodioxol-5-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one (PubChem CID 135658903) has the molecular formula C14H12N4O5S and a molecular weight of 348.34 g/mol. Its IUPAC name is 3-methyl-4-(6-nitro-1,3-benzodioxol-5-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one.
| Compound Name | 3-methyl-4-(6-nitro-1,3-benzodioxol-5-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one |
|---|---|
| PubChem CID | 135658903 |
| Molecular Formula | C14H12N4O5S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 3-methyl-4-(6-nitro-1,3-benzodioxol-5-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one |
| SMILES | Cc1[nH]nc2c1C(c1cc3c(cc1[N+](=O)[O-])OCO3)SCC(=O)N2 |
| InChI | InChI=1S/C14H12N4O5S/c1-6-12-13(24-4-11(19)15-14(12)17-16-6)7-2-9-10(23-5-22-9)3-8(7)18(20)21/h2-3,13H,4-5H2,1H3,(H2,15,16,17,19) |
| InChIKey | CLKHQVNFIKSSIB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|