C11H8N4OS — CID 135659492
4-[(Z)-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]benzonitrile (PubChem CID 135659492) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 4-[(Z)-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]benzonitrile.
| Compound Name | 4-[(Z)-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 135659492 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 4-[(Z)-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=N\N=C2\NC(=O)CS2)cc1 |
| InChI | InChI=1S/C11H8N4OS/c12-5-8-1-3-9(4-2-8)6-13-15-11-14-10(16)7-17-11/h1-4,6H,7H2,(H,14,15,16)/b13-6- |
| InChIKey | CKLMCYOVOPMMST-MLPAPPSSSA-N |
| XLogP | 1.11 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|