C16H16Cl2N4O3 — CID 135659801
2-methoxyethyl (7S)-7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135659801) has the molecular formula C16H16Cl2N4O3 and a molecular weight of 383.24 g/mol. Its IUPAC name is 2-methoxyethyl (7S)-7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl (7S)-7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135659801 |
| Molecular Formula | C16H16Cl2N4O3 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2-methoxyethyl (7S)-7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)Nc2ncnn2[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N4O3/c1-9-13(15(23)25-6-5-24-2)14(22-16(21-9)19-8-20-22)10-3-4-11(17)12(18)7-10/h3-4,7-8,14H,5-6H2,1-2H3,(H,19,20,21)/t14-/m0/s1 |
| InChIKey | YYVNOACFVWTIIT-AWEZNQCLSA-N |
| XLogP | 3.06 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|